| Name | 4-Amino-3-penten-2-one |
| Synonyms | FLUORAL-P ACETYLACETONAMINE ACETYLACETONE IMINE TIMTEC-BB SBB007945 4-AMINO-3-PENTEN-2-ONE 4-Amino-3-penten-2-one 4-AMINOPENT-3-EN-2-ONE (4E)-4-iminopentan-2-one (3E)-4-aminopent-3-en-2-one (3Z)-4-aminopent-3-en-2-one (3E)-4-Amino-3-penten-2-one 4-AMINOPENT-3-EN-2-ONE (FLUORAL-P) |
| CAS | 1118-66-7 |
| EINECS | 627-905-9 |
| InChI | InChI=1/C5H9NO/c1-4(6)3-5(2)7/h3H,6H2,1-2H3/b4-3+ |
| Molecular Formula | C5H9NO |
| Molar Mass | 99.13 |
| Density | 1.0343 (rough estimate) |
| Melting Point | 38 °C |
| Boling Point | 130-131 °C |
| Flash Point | 209-213°C |
| Water Solubility | Insoluble |
| Vapor Presure | 0.959mmHg at 25°C |
| Appearance | Orange to brown powder or solid |
| Color | White to Orange to Green |
| BRN | 1209344 |
| pKa | 5.93±0.70(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.4370 (estimate) |
| MDL | MFCD00043715 |
| Physical and Chemical Properties | Storage Conditions: 0-6 ℃ |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S22 - Do not breathe dust. |
| WGK Germany | 3 |
| HS Code | 29223990 |
| Hazard Note | Irritant |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |