| Name | L-2-Aminoadipic acid |
| Synonyms | AAD H-L-HOGLU-OH H-HOMOGLU-OH HOMOGLUTAMIC ACID 6-oxo-L-norleucine 2-aminohexanedioate L-α-Aminoadipic acid L-2-Aminoadipic acid AMINOADIPIC ACID, L-2- (S)-2-Aminoadipic acid 2-aminohexanedioic acid L-α-Aminohexanoic Diacid 2-AMINO-HEXANEDIOIC ACID ALPHA-AMINOHEXANDIOIC ACID (S)-2-Aminohexanedioic Acid (2S)-2-aminohexanedioic acid HEXANEDIOIC ACID, 2-AMINO-, (2S)- |
| CAS | 1118-90-7 |
| EINECS | 601-134-8 |
| InChI | InChI=1/C6H11NO4/c7-4(6(10)11)2-1-3-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11)/p-2 |
| InChIKey | OYIFNHCXNCRBQI-BYPYZUCNSA-N |
| Molecular Formula | C6H11NO4 |
| Molar Mass | 161.16 |
| Density | 1.3482 (rough estimate) |
| Melting Point | 203-205°C (dec.)(lit.) |
| Boling Point | 287.44°C (rough estimate) |
| Specific Rotation(α) | 22 º (c=2, 5 N HCl 25 ºC) |
| Flash Point | 173.9°C |
| Water Solubility | Soluble in 1N HCl (50 mg/ml) and water (slightly). |
| Vapor Presure | 2.74E-06mmHg at 25°C |
| Appearance | Solid |
| Color | White |
| BRN | 1724348 |
| pKa | 2.49±0.24(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.4230 (estimate) |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Use | glutamate synthase inhibitor. Gliotoxin |