| Name | 1-ethylnaphthalene |
| Synonyms | 1-ethyl-naphthalen 1-ETHYLNAPHTHALENE 1-ethylnaphthalene Naphthalene, 1-ethyl- alpha-Ethylnaphthalene ALPHA-1-ETHYLNAPHTHALENE 1-ETHYLNAPHTHALENE (ALPHA-) 1-ETHYLNAPHTHALENE, FOR FLUORESCENCE |
| CAS | 1127-76-0 |
| EINECS | 214-432-4 |
| InChI | InChI=1/C12H12/c1-2-10-7-5-8-11-6-3-4-9-12(10)11/h3-9H,2H2,1H3 |
| Molecular Formula | C12H12 |
| Molar Mass | 156.22 |
| Density | 1.008 g/mL at 25 °C (lit.) |
| Melting Point | -15--14 °C (lit.) |
| Boling Point | 258-260 °C (lit.) |
| Flash Point | 111 °C |
| Water Solubility | 10.7mg/L(25 ºC) |
| Vapor Presure | 0.0214mmHg at 25°C |
| Appearance | Transparent liquid |
| Color | Colorless to pale yellow |
| BRN | 1854417 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.606(lit.) |
| MDL | MFCD00004049 |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | QJ6950000 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |