| Name | 7-Fluorochroman-4-one |
| Synonyms | 7-FLUOROCHROMAN-4-ONE 7-Fluoro-4-chromanone 7-Fluoro-4-Chromanone 7-Fluorochroman-4-one 7-Fluorochroman-4-one, sum of isomers 7-fluoro-2,3-dihydro-4H-chromen-4-one 6-fluoro-3,4-dihydro-2H-1-benzopyran-4-one 4H-1-BENZOPYRAN-4-ONE, 7-FLUORO-2,3-DIHYDRO- |
| CAS | 113209-68-0 |
| InChI | InChI=1/C9H7FO2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-2,5H,3-4H2 |
| Molecular Formula | C9H7FO2 |
| Molar Mass | 166.15 |
| Density | 1.297±0.06 g/cm3(Predicted) |
| Melting Point | 46-50℃ |
| Boling Point | 281.9±40.0 °C(Predicted) |
| Flash Point | 120.5°C |
| Vapor Presure | 0.00347mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.539 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |