1132610-47-9 - Names and Identifiers
| Name | 2-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-1-(5-fluoro-6-methylpyridin-2-yl)ethanone
|
| Synonyms | 1-(5-Fluoro-6-Methyl-2-pyridinyl)-2-[1,2,4]triazolo[1,5-a]pyridin-6-yl-ethanone 2-([1,2,4]Triazolo[1,5-a]pyridin-6-yl)-1-(5-fluoro-6-methylpyridin-2-yl)ethanone 2-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-1-(5-fluoro-6-methylpyridin-2-yl)ethanone Ethanone, 1-(5-fluoro-6-Methyl-2-pyridinyl)-2-[1,2,4]triazolo[1,5-a]pyridin-6-yl-
|
| CAS | 1132610-47-9
|
| InChI | InChI=1S/C14H11FN4O/c1-9-11(15)3-4-12(18-9)13(20)6-10-2-5-14-16-8-17-19(14)7-10/h2-5,7-8H,6H2,1H3 |
1132610-47-9 - Physico-chemical Properties
| Molecular Formula | C14H11FN4O
|
| Molar Mass | 270.26 |
| Storage Condition | 2-8°C |
1132610-47-9 - Introduction
1-(5-fluoro-6-methyl-2-pyridyl)-2-[1,2,4] triazole [1,5-a] pyridyl-6-yl-ethanone, commonly referred to as FMPPT, is an organic compound. The following is a description of its nature, use, formulation and safety information:
Nature:
1. Appearance: FMPPT is a white crystalline solid.
2. Melting Point: The melting point of FMPPT is approximately 150-153°C.
3. Solubility: FMPPT can be dissolved in common organic solvents.
Use:
FMPPT has a wide range of applications in the field of medicine:
1. Anti-tumor drug: FMPPT is used as an anti-tumor compound and has the effect of inhibiting tumor growth.
2. immunomodulator: FMPPT can be used to regulate the function of the immune system, with anti-inflammatory, enhance immunity and other effects.
Preparation Method:
FMPPT is usually synthesized by chemical synthesis. The following is a common synthetic route:
1. First, 5-fluoro-6-methyl-2-pyridinamine is reacted with 2-pyridinecarboxaldehyde to generate the corresponding imine compound.
2. Next, the imine compound is subjected to a cyclization reaction with 1,2, 4-triazole in the presence of a catalyst to produce the target product FMPPT.
3. Finally, pure FMPPT is obtained by crystallization or other separation and purification methods.
Safety Information:
The security of FMPPT has not been fully assessed, so the following security measures need to be followed when handling and storing:
1. Avoid contact with skin, eyes and mucous membranes. Wear protective gloves, glasses and laboratory personal protective equipment when using.
2. Operate in a well-ventilated place to avoid inhaling its vapor or dust.
3. Keep FMPPT away from fire and oxidizing agents and store in a dry, cool place.
4. in the use or handling of the compound, should follow the relevant safety procedures and fire extinguishing measures.
It is important to note that the information provided in this introduction is for informational purposes only, and users should carefully read and follow accurate laboratory practices and relevant safety information when handling and handling the compound.
Last Update:2024-04-09 21:01:54