| Name | ALPHA-OCTITHIOPHENE |
| Synonyms | 8T alpha-8T α-Octithiophene ALPHA-OCTITHIOPHENE |
| CAS | 113728-71-5 |
| InChI | InChI=1/C32H18S8/c1-3-19(33-17-1)21-5-7-23(35-21)25-9-11-27(37-25)29-13-15-31(39-29)32-16-14-30(40-32)28-12-10-26(38-28)24-8-6-22(36-24)20-4-2-18-34-20/h1-18H |
| Molecular Formula | C32H18S8 |
| Molar Mass | 659.01 |
| Density | 1.425g/cm3 |
| Melting Point | 364 °C |
| Boling Point | 738.1°C at 760 mmHg |
| Flash Point | 306.9°C |
| Vapor Presure | 8.88E-21mmHg at 25°C |
| Appearance | powder to crystal |
| Color | Light yellow to Amber to Dark green |
| Storage Condition | Room Temprature |
| Refractive Index | 1.735 |