| Name | fmoc-D-leucine |
| Synonyms | FMOC-D-LEU Fmoc-D-Leu-OH FMOC-D-LEU-OH FMOC-D-LEUCINE fmoc-D-leucine n-fmoc-d-leucine FMOC-D-BETA-LEU-OH 9-FLUORENYLMETHOXYCARBONYL-D-LEUCINE N-[(9H-fluoren-9-ylmethoxy)carbonyl]leucine NALPHA-9-Fluorenylmethoxycarbonyl-D-leucine N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-leucine n-[(9h-fluoren-9-ylmethoxy)carbonyl]-d-leucine |
| CAS | 114360-54-2 |
| EINECS | 252-662-7 |
| InChI | InChI=1/C21H23NO4/c1-13(2)11-19(20(23)24)22-21(25)26-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19H,11-12H2,1-2H3,(H,22,25)(H,23,24)/t19-/m1/s1 |
| Molecular Formula | C21H23NO4 |
| Molar Mass | 353.41 |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| Melting Point | 155°C |
| Boling Point | 559.8±33.0 °C(Predicted) |
| Specific Rotation(α) | 25 ° (C=1, DMF) |
| Flash Point | 292.4°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 2.28E-13mmHg at 25°C |
| Appearance | Crystalline powder |
| Color | White to Almost white |
| pKa | 3.91±0.21(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 25 ° (C=1, DMF) |
| MDL | MFCD00062957 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10 |
| HS Code | 29224999 |
| introduction | Fmoc-D-leucine is white to off-white crystalline powder, which is the N-fmoc protected form of D-leucine. D-leucine, an unnatural isomer of L-leucine, acts as a self-inhibitor of Streptococcus lactis in culture. D-leucine causes analgesia in humans and also exhibits inhibitory activity in bacterial cell culture. |
| Synthesis method | In the presence of alkali, 9-fluorenomethoxycarbonyl chloride reacts with leucine to obtain FMOC-D-leucine. This method is simple to operate, The method of preparing FMOC-D-leucine with mild reaction conditions, high yield and wide applicability. The synthesis reaction formula of FMOC-D-leucine is as follows: |