| Name | Breviscapin |
| Synonyms | Lamps, BREVISCAPIN Breviscapin Breviscapine Scutellarin hydrate Breviscapine,Erigeron Breviscapus A natural extract containing apigenin 7-glucuronide and scutellarein 7-glucuronide 5,6-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranosiduronic acid 4H-1-benzopyran-4-one, 7-(beta-D-glucopyranuronosyloxy)-5,6-dihydroxy-2-(4-hydroxyphenyl)- 7-(β-D-Glucopyranuronosyloxy)-5,6-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one hydrate 5,6-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-7-yl--D-glucopyranosiduronic acid hydrate |
| CAS | 116122-36-2 |
| InChI | InChI=1/C21H18O12/c22-8-3-1-7(2-4-8)10-5-9(23)13-11(31-10)6-12(14(24)15(13)25)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-22,24-28H,(H,29,30)/t16-,17-,18+,19-,21+/m0/s1 |
| Molecular Formula | C21H18O11.C21H18O12 |
| Molar Mass | 908.723 |
| Density | 1.81g/cm3 |
| Boling Point | 891.6°C at 760 mmHg |
| Flash Point | 314.9°C |
| Vapor Presure | 3.91E-34mmHg at 25°C |
| Appearance | Yellow powder |
| Storage Condition | 2-8°C |
| Refractive Index | 1.763 |
| Use | Vasodilators, for the treatment of ischemic cerebrovascular disease |
| Reference Show more | 1. Zhang Lijun, Wu Yingying, Wu Jinjin, Shi Senlin. In vitro release and biological adhesion of breviscapine thermosensitive nasal in situ gel [J]. Chinese Modern Applied Pharmacy, 2020,37(23):2863-2867. |
| use | promoting blood circulation and removing blood stasis, dredging collaterals and relieving pain. Suitable for hemiplegia, cerebral infarction, cerebral tethered formation, stroke sequelae, coronary heart disease, angina pectoris, ischemic heart disease, senile dementia, hyperviscosity, vertigo, etc. |