| Name | 3-BROMO-4-FLUOROPYRIDINE |
| Synonyms | 3-BROMO-4-FLUOROPYRIDINE 4-FLUORO-3-BROMOPYRIDINE Pyridine,3-broMo-4-fluoro- |
| CAS | 116922-60-2 |
| EINECS | 000-000-0 |
| InChI | InChI=1/C5H3BrFN/c6-4-3-8-2-1-5(4)7/h1-3H |
| InChIKey | PKYADCLPLQPPKK-UHFFFAOYSA-N |
| Molecular Formula | C5H3BrFN |
| Molar Mass | 175.99 |
| Density | 1.718 g/mL at 25 °C |
| Boling Point | 70 °C(Press: 20 Torr) |
| Flash Point | >110℃ |
| Vapor Presure | 2.1mmHg at 25°C |
| pKa | 1.75±0.18(Predicted) |
| Storage Condition | Inert atmosphere,2-8°C |
| Refractive Index | n20/D1.542 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S39 - Wear eye / face protection. |