| Name | 3-Chlorophthalic anhydride |
| Synonyms | Ktoyupd CHLORPHTHALIDONE 3-Chlorophthalic anhydride 3-CHLOROPHTHALIC ANHYDRIDE 4-chloro-2-benzofuran-1,3-dione 3-CHLOROPHTHALIC ACID ANHYDRIDE 4-Chloro-isobenzofuran-1,3-dione 1,3-Isobenzofurandione, 4-chloro- 4-chloro-1,3-dihydro-2-benzofuran-1,3-dione 4-Chloro-2-benzofuran-1,3-dione, 4-Chloroisobenzofuran-1,3-dione |
| CAS | 117-21-5 |
| EINECS | 204-179-8 |
| InChI | InChI=1/C8H3ClO3/c9-5-3-1-2-4-6(5)8(11)12-7(4)10/h1-3H |
| Molecular Formula | C8H3ClO3 |
| Molar Mass | 182.56 |
| Density | 1.594±0.06 g/cm3(Predicted) |
| Melting Point | 123-126 °C |
| Boling Point | 170°C(lit.) |
| Flash Point | 152.2°C |
| Vapor Presure | 0.02-0.08Pa at 25℃ |
| Appearance | Colorless solid |
| Color | White or pale yellow |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.626 |
| MDL | MFCD00023107 |
| Physical and Chemical Properties | Colorless solid, melting point of 124 ℃, boiling point of 313 ℃, non-toxic and tasteless at room temperature. |
| Use | Used as a dye, pharmaceutical and pesticide intermediates, at the same time is a raw material for the synthesis of polyimide |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| HS Code | 29173995 |
| LogP | 2.713 |
| use | 3-chloro-phthalic anhydride can be used for the synthesis of 1-chloroanthraquinone and other anthraquinone series dyes. It is used as an intermediate of dyes, medicines and pesticides, and is also a raw material for the synthesis of polyimides |