| Name | ethyl 2-[(3,5-dibromo-4-hydroxyphenyl)(3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene)methyl]benzoate |
| Synonyms | PHENOLTETRABROMOPHTHALEIN TETRABROMOPHENOLPHTHALEIN ETHYL ESTER Tetrabromophenolphthalein ethyl ester, pure 3',3'',5',5''-Tetrabromophenolphthaleineethylester 3',3'',5',5''-Tetrabromophenolphthalein ethyl ester TBPE, 3μ,3,5μ,5-Tetrabromophenolphthaleinethyl ester benzoicacid,2-[(3,5-dibromo-4-hydroxyphenyl)(3,5-dibromo-4-oxo-2,5-cyclohexad ethyl 2-[(3,5-dibromo-4-hydroxyphenyl)(3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene)methyl]benzoate Benzoic acid, 2-[(3,5-dibromo-4-hydroxyphenyl) (3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene )methyl]-, ethyl ester |
| CAS | 1176-74-5 |
| EINECS | 214-645-2 |
| InChI | InChI=1/C22H14Br4O4.K/c1-2-30-22(29)14-6-4-3-5-13(14)19(11-7-15(23)20(27)16(24)8-11)12-9-17(25)21(28)18(26)10-12;/h3-10,27H,2H2,1H3;/q;+1/p-1 |
| Molecular Formula | C22H14Br4O4 |
| Molar Mass | 661.96 |
| Density | 1.9236 (rough estimate) |
| Melting Point | 208-211 °C |
| Boling Point | 619.9±55.0 °C(Predicted) |
| Flash Point | 328.7°C |
| Vapor Presure | 5.87E-16mmHg at 25°C |
| Appearance | Orange to orange brown or red to reddish brown powder or solid |
| Color | Yellow to red |
| BRN | 2228548 |
| pKa | 6.25±0.40(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Sensitive to light and air |
| Refractive Index | 1.5000 (estimate) |
| MDL | MFCD00066387 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8-10-23 |
| HS Code | 29189900 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |