| Name | 3,5-Dimethyl-2,6-dibromopyridine |
| Synonyms | 2,6-dibromo-3,5-dimethylpyridine 3,5-Dimethyl-2,6-dibromopyridine pyridine, 2,6-dibromo-3,5-dimethyl- Pyridine, 2,6-dibromo-3,5-dimethyl- |
| CAS | 117846-58-9 |
| InChI | InChI=1/C7H7Br2N/c1-4-3-5(2)7(9)10-6(4)8/h3H,1-2H3 |
| Molecular Formula | C7H7Br2N |
| Molar Mass | 264.95 |
| Density | 1.795±0.06 g/cm3(Predicted) |
| Melting Point | 107-108 °C |
| Boling Point | 303.1±37.0 °C(Predicted) |
| Flash Point | 137.1°C |
| Vapor Presure | 0.00171mmHg at 25°C |
| pKa | -3.07±0.20(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.583 |
| Overview | Pyridine and its derivatives are widely distributed in nature. Many plant components, such as alkaloids, contain pyridine ring compounds in their structures. They are the basis for the production of many important compounds and are indispensable raw materials in the production of medicines, pesticides, dyes, surfactants, rubber additives, feed additives, food additives, adhesives, etc. |
| use | 3,5-dimethyl -2,6-dibromopyridine is an important intermediate in organic synthesis, mainly used in pharmaceutical intermediates, organic synthesis, organic solvents, and can also be used in dye production, pesticide production and perfume production. |