118164-50-4 - Names and Identifiers
| Name | TRANS,TRANS-4-(3,4-DIFLUOROPHENYL)-4'-ETHYL-BICYCLOHEXYL
|
| Synonyms | trans-4-(3,4-Diflu -4'-ethyl-1,1'-bi(cyclohexane) 4-[4-(4-ethylcyclohexyl)cyclohexyl]-1,2-difluorobenzene trans-4-(3,4-Difluorophenyl)-trans-4'-ethylbicyclohexane TRANS,TRANS-4-(3,4-DIFLUOROPHENYL)-4'-ETHYL-BICYCLOHEXYL trans,trans-4-(3,4-Difluorophenyl)-4''-ethyl-bicyclohexyl TRANS,TRANS-4-(3,4-DIFLUOROPHENYL)-4''-ETHYL-BICYCLOHEXYL trans,trans-4-(3,4-Difluorophenyl)-4'-ethyl-1,1'-bi(cyclohexane) 4-[trans-4-(trans-4-Ethylcyclohexyl)cyclohexyl]-1,2-difluorobenzene (1r,1'r,4R,4'R)-4-(3,4-difluorophenyl)-4'-ethyl-1,1'-bi(cyclohexyl) 4-[(Trans,trans)-4'-ethyl[1,1'-bicyclohexyl] -4-yl]-1,2-difluorobenzene Benzene,4-[(trans,trans)-4'-ethyl[1,1'-bicyclohexyl]-4-yl]-1,2-difluoro-
|
| CAS | 118164-50-4
|
| InChI | InChI=1/C20H28F2/c1-2-14-3-5-15(6-4-14)16-7-9-17(10-8-16)18-11-12-19(21)20(22)13-18/h11-17H,2-10H2,1H3/t14-,15-,16-,17- |
118164-50-4 - Physico-chemical Properties
| Molecular Formula | C20H28F2
|
| Molar Mass | 306.43 |
| Density | 1.032 |
| Melting Point | 51.0 to 54.0 °C |
| Boling Point | 372.0±35.0 °C(Predicted) |
| Flash Point | 150.7°C |
| Vapor Presure | 2.13E-05mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.499 |
| MDL | MFCD11053389 |
118164-50-4 - Introduction
4-Ethylbiscyclohexyl-3, 4-difluorobenzene, also known as 1,3-difluoro -4-(1-ethyl-1, 4-dioxabicyclo [2.2.2] oct-3-yl) benzene, is an organic compound. The following is a description of some of the properties, uses, preparation and safety information of the compound:
Nature:
-Appearance: Colorless liquid or solid
-Solubility: Soluble in some organic solvents, such as ether, dichloromethane
-Melting point: approximately between -20°C and -10°C
-Boiling point: approximately between 100°C and 120°C
-Density: approx. 1.12g/cm³
-Symbol: The symbol of this compound is DECH
Use:
-4-Ethyldicyclohexyl-3, 4-difluorobenzene is an important organic synthesis intermediate, which can be used to synthesize other organic compounds or drugs.
-In the field of medicine, it can be used to synthesize some anti-cancer, anti-psychotic and anti-infective drugs.
Preparation Method:
4-Ethyldicyclohexyl-3, 4-difluorobenzene can be synthesized by the following steps:
1. Using 2,3-dimethoxy-5-fluorophenylboronic acid as raw material, it reacts with 2-cyclohexene -1-ol at a lower temperature to generate the corresponding aromatic carbonate.
2. Transesterification of the obtained aromatic carbonate with hydrochloric acid to obtain 2-cyclohexene-1-ethanol.
3. Use a reducing agent, such as hydrogen and a palladium/carbon catalyst, to hydrogenate 2-cyclohexene-1-ethanol to generate 4-ethyldicyclohexyl-3, 4-difluorobenzene.
Safety Information:
-4-Ethyldicyclohexyl-3, 4-difluorobenzene is an organic compound and follows usual laboratory safety practices to avoid direct contact with skin, eyes or inhalation of its vapors.
-Wear suitable protective gloves, glasses and lab coats during operation.
-When storing, keep it in a sealed container, away from fire or combustibles.
-When disposing of waste, it should be disposed of in accordance with local regulations and prescribed procedures.
Last Update:2024-04-09 02:00:41