| Name | 3-Cyclopropyl-3-oxopropanenitrile |
| Synonyms | β-oxo-Cyclopropylpropanenitrile b-Oxo-cyclopropanepropanenitrile 3-CYCLOPROPYL-3-OXO-PROPIONITRILE 3-Cyclopropyl-3-oxopropanenitrile Cyclopropanepropanenitrile, β-oxo- |
| CAS | 118431-88-2 |
| InChI | InChI=1/C6H7NO/c7-4-3-6(8)5-1-2-5/h5H,1-3H2 |
| Molecular Formula | C6H7NO |
| Molar Mass | 109.13 |
| Density | 1.156±0.06 g/cm3(Predicted) |
| Boling Point | 124-128 °C(Press: 21 Torr) |
| Flash Point | 67.448°C |
| Vapor Presure | 0.615mmHg at 25°C |
| pKa | 9.90±0.20(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.496 |
| application | 3-cyclopropyl-3-oxopropionitrile is a nitrile derivative and can be used as a pharmaceutical intermediate. |