| Name | 4,4'-Bis[4-(di-p-tolylamino)styryl]biphenyl |
| Synonyms | DPAVBi DPAVBI LT-E605 -BIS[4-(DI-P-TOLYLAMINO)STYRYL]BIPHENYL 4,4'-Bis[4-(di-p-tolylamino)styryl]biphenyl 4,4'-Bis[4-(di-p-tolylamino)styryl] biphenyl DPAVBi , 4,4-Bis[4-(di-p-tolylaMino)styryl]biphenyl 4,4'-Bis[4-(di-p-tolylamino)styryl]biphenyl, purified by sublimation 4,4'-[biphenyl-4,4'-diyldi(E)ethene-2,1-diyl]bis[N,N-bis(4-methylphenyl)aniline] 4,4'-([1,1'-Biphenyl]-4,4'-diyldi-2,1-ethenediyl)bis[N,N-bis(4-methylphenyl)benzenamine 4,4'-((1E,1'E)-[1,1'-biphenyl]-4,4'-diylbis(ethene-2,1-diyl))bis(N,N-di-p-tolylaniline) |
| CAS | 119586-44-6 |
| EINECS | 808-006-2 |
| InChI | InChI=1/C56H48N2/c1-41-5-29-51(30-6-41)57(52-31-7-42(2)8-32-52)55-37-21-47(22-38-55)15-13-45-17-25-49(26-18-45)50-27-19-46(20-28-50)14-16-48-23-39-56(40-24-48)58(53-33-9-43(3)10-34-53)54-35-11-44(4)12-36-54/h5-40H,1-4H3/b15-13+,16-14+ |
| Molecular Formula | C56H48N2 |
| Molar Mass | 748.99 |
| Density | 1.154 |
| Melting Point | 232-234 °C |
| Boling Point | 896.1±65.0 °C(Predicted) |
| Flash Point | 381.6°C |
| Vapor Presure | 8.19E-33mmHg at 25°C |
| Appearance | powder to crystal |
| Color | Light yellow to Amber to Dark green |
| Odor | Greenish-yellow crystals/powder |
| pKa | -1.72±0.60(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.707 |
| Absorption | λmax 405 nm in THF |