| Name | 1,3-dichlorotetrafluorobenzene |
| Synonyms | CCRIS 4138 4-flurobenzenenitrile 1,3-dichlorotetrafluorobenzene 1,3-DICHLOROTETRAFLUOROBENZENE 1,3-Dichlorotetrafluorobenzene Benzene, 1,3-dichlorotetrafluoro- 2,4,5,6-Tetrafluoro-1,3-dichlorobenzene 1,3-Dichloro-2,4,5,6-tetrafluorobenzene 2,4,5,6-Tetrafluoro-1,3-phenylene dichloride |
| CAS | 1198-61-4 |
| EINECS | 214-835-5 |
| InChI | InChI=1/C6Cl2F4/c7-1-3(9)2(8)5(11)6(12)4(1)10 |
| Molecular Formula | C6Cl2F4 |
| Molar Mass | 218.96 |
| Density | 1.652g/mLat 25°C(lit.) |
| Boling Point | 150-152°C(lit.) |
| Flash Point | 164°F |
| Refractive Index | n20/D 1.468(lit.) |
| Physical and Chemical Properties | Boiling Point, 150 ℃-152 ℃, Flash Point 73 ℃, refractive index 1.4680, specific gravity 1.652. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| Use | Pharmaceutical, pesticide, liquid crystal material intermediates. |