| Name | 3-Phenylbut-2-enoic acid |
| Synonyms | B-METHYLCINNAMIC ACID beta-Methylcinnamicacid 3-PHENYLBUT-2-ENOIC ACID 3-Phenylbut-2-enoic acid 3-Phenyl-2-butenoic acid 2-Butenoic acid, 3-phenyl- (2Z)-3-phenylbut-2-enoic acid (2E)-3-phenylbut-2-enoic acid (2E)-3-(3-methylphenyl)prop-2-enoic acid |
| CAS | 1199-20-8 |
| EINECS | 221-199-2 |
| InChI | InChI=1/C10H10O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12)/b8-7+ |
| Molecular Formula | C10H10O2 |
| Molar Mass | 162.19 |
| Density | 1.119g/cm3 |
| Boling Point | 281.9°C at 760 mmHg |
| Flash Point | 188.2°C |
| Vapor Presure | 0.00164mmHg at 25°C |
| Storage Condition | Room Temprature |
| Refractive Index | 1.561 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Uses | 3-phenylbutyl-2-enoic acid can be used to synthesize 2-position disubstituted indolin-3-ketone compounds. |
| Preparation | 3-phenylbutyl-2-enoic acid can be prepared from triethyl phosphonoacetate and phenylacetaldehyde in one step. |