| Name | 4-Ethoxy-3-methoxybenzaldehyde |
| Synonyms | AKOS B028863 AKOS BBS-00003242 4-Ethoxy-m-anisaldehyd 4-ETHOXY-M-ANISALDEHYDE 4-ETHOXY-3-ANISALDEHYDE 4-Ethoxy-m-anisaldehyde 4-ETHOXY-3-METHOXYBENZALDEHYDE 4-Ethoxy-3-methoxybenzaldehyde 3-Methoxy- 4-ethoxy benzaldehyde |
| CAS | 120-25-2 |
| EINECS | 204-382-1 |
| InChI | InChI=1/C10H12O3/c1-3-13-9-5-4-8(7-11)6-10(9)12-2/h4-7H,3H2,1-2H3 |
| Molecular Formula | C10H12O3 |
| Molar Mass | 180.2 |
| Density | 1.1272 (rough estimate) |
| Melting Point | 50-53 °C (lit.) |
| Boling Point | 168 °C |
| Flash Point | 110 °C |
| Water Solubility | slightly soluble |
| Vapor Presure | 0.0022mmHg at 25°C |
| Appearance | Yellow solid |
| Color | Yellow |
| BRN | 391169 |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Sensitive | Air Sensitive |
| Refractive Index | 1.5224 (estimate) |
| MDL | MFCD00016614 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29124900 |
| Hazard Class | IRRITANT |
| Reference Show more | 1. [IF=2.424] Haona Yang et al."The potential of Myosoton aquaticum extracts and compounds to control barnyardgrass (Echinochloa crus-galli)."Weed Res. 2021 Aug;61(4):317-326 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |