| Name | Phenylphosphinic acid |
| Synonyms | phenylphosphonous acid Benzenephosphinic acid hydroxy(oxo)phenylphosphonium |
| CAS | 121-70-0 1779-48-2 |
| EINECS | 217-217-3 |
| InChI | InChI=1/C6H7O2P/c7-9(8)6-4-2-1-3-5-6/h1-5,9H,(H,7,8) |
| Molecular Formula | C6H7O2P |
| Molar Mass | 142.09 |
| Melting Point | 83-85°C(lit.) |
| Boling Point | 285.112°C at 760 mmHg |
| Flash Point | 126.231°C |
| Water Solubility | 7.7 g/100 mL (25℃) |
| Vapor Presure | 0.001mmHg at 25°C |
| Appearance | White crystal |
| Storage Condition | Room Temprature |
| MDL | MFCD00002131 |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R22 - Harmful if swallowed R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| RTECS | SZ5462500 |