121399-88-0 - Names and Identifiers
| Name | 2,3,7,8,12,13,17,18-Octafluoro-5,10,15,20-tetrakis(pentafluorophenyl)-21H,23H-porphine Perfluoro-5,10,15,20-tetraphenyl-21H,23H-porphine
|
| Synonyms | Perfluoro-5,10,15,20-tetraphenyl-21H,23H-porphine Perfluoro-5,10,15,20-tetraphenyl-21H,23H-porphyrin 2,3,7,8,12,13,17,18-Octafluoro-5,10,15,20-tetrakis(pentafluorophenyl)porphyrin 2,3,7,8,12,13,17,18-Octafluoro-5,10,15,20-tetrakis(pentafluorophenyl)-21H,23H-porphine 2,3,7,8,12,13,17,18-octafluoro-5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin Perfluoro-5,10,15,20-tetraphenyl-21H,23H-porphyrin2,3,7,8,12,13,17,18-Octafluoro-5,10,15,20-tetrakis(pentafluorophenyl)-21H,23H-porphine
|
| CAS | 121399-88-0
|
| InChI | InChI=1/C44H2F28N4/c45-9-1(10(46)18(54)25(61)17(9)53)5-37-29(65)31(67)39(73-37)6(2-11(47)19(55)26(62)20(56)12(2)48)41-33(69)35(71)43(75-41)8(4-15(51)23(59)28(64)24(60)16(4)52)44-36(72)34(70)42(76-44)7(40-32(68)30(66)38(5)74-40)3-13(49)21(57)27(63)22(58)14(3)50/h73,76H/b37-5-,38-5-,39-6-,40-7-,41-6-,42-7-,43-8-,44-8- |
121399-88-0 - Physico-chemical Properties
| Molecular Formula | C44H2F28N4
|
| Molar Mass | 1118.47 |
| Appearance | powder to crystal |
| Color | Orange to Brown to Dark purple |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.582 |
121399-88-0 - Introduction
2,3,7,8,12,13,17,18-octafluoro -5,10,15,20-tetrakis (pentafluorophenyl) porphyrin is a photosensitive organic compound with a variety of important properties and applications.
Nature:
1. 2,3,7,8,12,13,17,18-octafluoro -5,10,15,20-tetrakis (pentafluorophenyl) porphyrin is a deep red crystalline solid.
2. It has high light absorption performance and strong absorption capacity in the visible and near-infrared light regions.
3. It has good solubility and can be dissolved in some organic solvents, such as dichloromethane, methanol, etc.
4. It is a stable compound and is not easily affected by factors such as light, heat or oxidation.
Use:
1. 2,3,7,8,12,13,17,18-octafluoro -5,10,15,20-tetrakis (pentafluorophenyl) porphyrin is widely used in optoelectronics, photocatalysis and photosensitive materials.
2. It can be used as a photosensitive dye for photoelectric conversion devices, photosensitizers, light-curing materials, etc.
3. It can also be used as a metal ion coordination reagent for metal ion detection and separation and purification.
Preparation Method:
Generally, 2,3,7,8,12,13, 17,18-octafluoro -5,10,15,20-tetrakis (pentafluorophenyl) porphyrin can be obtained by synthesis. A common method is to react the appropriate compound with pentafluorobenzoic acid and then synthesize the target product through a multi-step reaction.
Safety Information:
1. 2,3,7,8,12,13,17,18-octafluoro -5,10,15,20-tetrakis (pentafluorophenyl) porphyrin is an organic compound with strong irritation and toxicity.
2. During operation and storage, avoid contact with skin and avoid inhalation or intake.
3. Personal protective equipment such as chemical protective gloves, goggles and protective clothing should be worn during use.
4. in case of accidental inhalation or skin contact, rinse with water immediately and seek medical treatment.
Last Update:2024-04-09 02:00:41