| Name | 2-methyl-1-nitroanthraquinone |
| Synonyms | NSC 8 2-methyl-1-nitroanthraquinone 2-Methyl-1-Bitroanthraquinone 1-NITRO-2-METHYLANTHRAQUINONE 2-Methyl-1-nitro-9,10-anthraquinone 1-Nitro-2-methyl-9,10-anthraquinone 2-methyl-1-nitroanthracene-9,10-dione 9,10-Anthracenedione, 2-methyl-1-nitro- 2-Methyl-1-nitroanthraquinone (of uncertain purity) |
| CAS | 129-15-7 |
| EINECS | 204-932-0 |
| InChI | InChI=1/C15H9NO4/c1-8-6-7-11-12(13(8)16(19)20)15(18)10-5-3-2-4-9(10)14(11)17/h2-7H,1H3 |
| Molecular Formula | C15H9NO4 |
| Molar Mass | 267.24 |
| Density | 1.2671 (rough estimate) |
| Melting Point | 270~271℃ |
| Boling Point | 410.42°C (rough estimate) |
| Flash Point | 248.7°C |
| Vapor Presure | 9.98E-10mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.6231 (estimate) |
| Physical and Chemical Properties | The trait was characterized by precipitation of pale yellow needle-like crystals from acetic acid. melting point 270~271 ℃ solubility insoluble in water. Almost insoluble in ethanol, ether. Slightly soluble in benzene, chloroform, acetic acid, ethyl acetate. Soluble in nitrobenzene. |
| Use | For the preparation of 1-nitro-2-anthraquinone formic acid and other intermediates and reduced yellow 4GF, reduced red F3B and blue ER and other vat dyes |
| (IARC) carcinogen classification | 2B (Vol. 27, Sup 7) 1987 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | used to prepare intermediates such as 1-nitro-2-anthraquinone formic acid and reduce reduction dyes such as yellow 4GF, reduced red F3B and reduced blue ER |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |