| Name | 1,5-Diaminoanthraquinone |
| Synonyms | smokeredf ,5-DIAMINOANTHRAQUINONE 1,5-Diaminoanthraquinone 1,5-DIAMINOANTHRAQUINONE 1,5-ANTHRAQUINONYLDIAMINE 10-Anthracenedione,1,5-diamino-9 9,10-Anthracenedione,1,5-diamino- 1,5-bis(azanyl)anthracene-9,10-dione |
| CAS | 129-44-2 |
| EINECS | 204-947-2 |
| InChI | InChI=1/C14H10N2O2/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6H,15-16H2 |
| Molecular Formula | C14H10N2O2 |
| Molar Mass | 238.24 |
| Density | 1.1907 (rough estimate) |
| Melting Point | >300 °C (lit.) |
| Boling Point | 380.84°C (rough estimate) |
| Flash Point | 287.6°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 3.17E-12mmHg at 25°C |
| Appearance | Red to reddish brown powder |
| Color | Orange to Brown to Dark red |
| pKa | -0.66±0.20(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.6500 (estimate) |
| MDL | MFCD00001226 |
| Physical and Chemical Properties | Character deep red needle Crystal (in ethanol, acetic acid). melting point 308 ℃ (decomposition) solubility: soluble in hot nitrobenzene, slightly soluble in ethanol, ether, benzene, acetone, chloroform. |
| Use | For the manufacture of dyes |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| RTECS | CB6400000 |
| TSCA | Yes |
| HS Code | 29147000 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | used to make dyes dye intermediates, used to produce reduced ash 3T, reduced orange 3C, dispersed blue, etc. |
| production method | anthraquinone is nitrated with mixed acid in concentrated sulfuric acid to obtain 1,5-dinitroanthraquinone, filtered, washed, then reduced with sodium sulfide, filtered, washed and dried to obtain the product. |