| Name | 3-(4-BROMOPHENYL)PYRIDINE |
| Synonyms | 3-(4-BROMOPHENYL)PYRIDINE Pyridine, 3-(4-bromophenyl)- pyridine, 3-(4-bromophenyl)- 1-bromo-4-(pyridin-3-yl)-benzene |
| CAS | 129013-83-8 |
| EINECS | 807-991-6 |
| InChI | InChI=1/C11H8BrN/c12-11-5-3-9(4-6-11)10-2-1-7-13-8-10/h1-8H |
| Molecular Formula | C11H8BrN |
| Molar Mass | 234.09 |
| Density | 1.426±0.06 g/cm3(Predicted) |
| Melting Point | 38.0 to 42.0 °C |
| Boling Point | 331.9±17.0 °C(Predicted) |
| Flash Point | 154.5°C |
| Vapor Presure | 0.000291mmHg at 25°C |
| pKa | 4.70±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.606 |
| use | 3-(4-bromophenyl) pyridine is used in laboratory research and development and chemical and pharmaceutical synthesis. |