| Name | 4-Chloro-2,5-difluorobenzoic acid |
| Synonyms | QVR DG BF EF TIMTEC-BB SBB003617 2,5-Difluoro-4-chlorobenzoic 4-chloro-2,5-difluorobenzoate 2,5-Difluoro-4-chlorobenzoicacid 4-Chloro-2,5-difluorobenzoic acid 2,5-DIFLUORO-4-CHLOROBENZOIC ACID 4-CHLORO-2,5-DIFLUOROBENZOIC ACID Benzoic acid, 4-chloro-2,5-difluoro- 4-chloro-2,5-difluorobenzoyl chloride |
| CAS | 132794-07-1 |
| InChI | InChI=1/C7H3ClF2O2/c8-4-2-5(9)3(7(11)12)1-6(4)10/h1-2H,(H,11,12)/p-1 |
| Molecular Formula | C7H3ClF2O2 |
| Molar Mass | 192.55 |
| Density | 1.4821 (estimate) |
| Melting Point | 154-157 °C (lit.) |
| Boling Point | 258°C (rough estimate) |
| Flash Point | 121.6°C |
| Vapor Presure | 0.00217mmHg at 25°C |
| Appearance | White to white-like powder |
| Color | Off-white |
| pKa | 2.70±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| MDL | MFCD00077480 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Hazard Class | IRRITANT |
| Application | 4-chloro-2, 5-difluorobenzoic acid (4-chloro-2, 5-difluorobenzoic acid acid) it is a drug intermediate, which can be used to synthesize drugs that promote insulin secretion and inhibit the increase of blood glucose concentration, and can also be used to synthesize intermediates of protein kinase inhibitors, it is also possible to synthesize an isothiazole derivative which is an intermediate of an anticancer drug. |