| Name | 1,4-bis(4-methyl-α -styryl)benzene |
| Synonyms | BIS(MSB) -styryl)benzene 4-Bis(2-methylstyryl)benzene 1,4-DI(2-METHYLSTYRYL)BENZENE Bis(MSB), scintillation grade 1,4-BIS(2-METHYLSTYRYL)BENZENE 1,4-Bis(4-methyl-alpha-styryl)benzene 1,4-bis[2-(2-methylphenyl)ethenyl]-benzen Benzene, 1,4-bis(2-(2-methylphenyl)ethenyl)- 2,2'-[1,4-Phenylenebis(ethene-1,2-diyl)]bistoluene 1,1'-(benzene-1,4-diyldiethene-2,1-diyl)bis(2-methylbenzene) 1,1'-[benzene-1,4-diyldi(E)ethene-2,1-diyl]bis(2-methylbenzene) |
| CAS | 13280-61-0 |
| EINECS | 236-285-5 |
| InChI | InChI=1/C24H22/c1-19-7-3-5-9-23(19)17-15-21-11-13-22(14-12-21)16-18-24-10-6-4-8-20(24)2/h3-18H,1-2H3/b17-15+,18-16+ |
| Molecular Formula | C24H22 |
| Molar Mass | 310.43 |
| Density | 1.0591 (estimate) |
| Melting Point | 180-182°C(lit.) |
| Boling Point | 385.59°C (rough estimate) |
| Flash Point | 231.3°C |
| Vapor Presure | 2.58E-08mmHg at 25°C |
| Appearance | White to yellow or yellow-green powder or crystal |
| Color | Light green to yellow-green |
| BRN | 2375845 |
| Storage Condition | Store below +30°C. |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Sensitive | Light Sensitive |
| Refractive Index | 1.9130 (estimate) |
| MDL | MFCD00008529 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36 - Irritating to the eyes |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-23 |
| TSCA | Yes |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | suitable for laser dye |