| Name | 2(3H)-Benzothiazolone,6-acetyl-(9CI) |
| Synonyms | 6-Acetylbenzo[d]thiazol-2(3H) 2(3H)-Benzothiazolone, 6-acetyl- 6-acetylbenzo[d]thiazol-2(3H)-one 6-acetyl-3H-1,3-benzothiazol-2-one 6-acetyl-1,3-benzothiazole-2(3)-one 6-acetyl-1,3-benzothiazol-2(3H)-one 2(3H)-Benzothiazolone,6-acetyl-(9CI) |
| CAS | 133044-44-7 |
| EINECS | 681-107-5 |
| InChI | InChI=1/C9H7NO2S/c1-5(11)6-2-3-7-8(4-6)13-9(12)10-7/h2-4H,1H3,(H,10,12) |
| Molecular Formula | C9H7NO2S |
| Molar Mass | 193.22 |
| Density | 1.360±0.06 g/cm3(Predicted) |
| Melting Point | 190-194 °C |
| pKa | 9.76±0.20(Predicted) |
| Refractive Index | 1.635 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |