| Name | N-Benzyl-N-Cyclopropylamine |
| Synonyms | N-Benzylcyclopropymaine N-Benzylcyclopropylamine N-Cyclopropylbenzylamine N-Benzylcyclopropanamine N-BENZYLCYCLOPROPANAMINE N-BENZYLCYCLOPROPYLAMINE N-Cyclopropyl-benzylamine N-BENZYL-N-CYCLOPROPYLAMINE N-Benzyl-N-Cyclopropylamine Benzenemethanamine, N-cyclopropyl- |
| CAS | 13324-66-8 |
| InChI | InChI=1/C10H13N/c1-2-4-9(5-3-1)8-11-10-6-7-10/h1-5,10-11H,6-8H2 |
| Molecular Formula | C10H13N |
| Molar Mass | 147.22 |
| Density | 1.01±0.1 g/cm3(Predicted) |
| Melting Point | 97-98.5 °C |
| Boling Point | 80-81 °C(Press: 5 Torr) |
| Flash Point | 92.8°C |
| Vapor Presure | 0.0681mmHg at 25°C |
| pKa | 8.47±0.20(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.557 |
| Hazard Symbols | T - Toxic![]() |
| Risk Codes | 25 - Toxic if swallowed |
| Safety Description | 45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |