| Name | 4-bromo-2,5-difluorobenzonitrile |
| Synonyms | 4-bromo-2,5-difluorobenzonitrile 2,5-difluoro-4-bromobenzonitrile Benzonitrile, 4-bromo-2,5-difluoro- |
| CAS | 133541-45-4 |
| InChI | InChI=1S/C7H2BrF2N/c8-5-2-6(9)4(3-11)1-7(5)10/h1-2H |
| Molecular Formula | C7H2BrF2N |
| Molar Mass | 218 |
| Density | 1.77±0.1 g/cm3(Predicted) |
| Boling Point | 224.6±35.0 °C(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| MDL | MFCD11847049 |
| application | 4-bromo -2,5-difluorobenzonitrile can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development process and chemical production process. |