| Name | 2-Bromo-5-nitrobenzonitrile |
| Synonyms | Bromo-5-nitrobenzonitrile 2-Bromo-5-nitrobenzonitrile 2-BroMo-5-nitrobenzonitrile 2-BROMO-5-NITROBENZONITRILE Benzonitrile, 2-bromo-5-nitro- 2-Bromo-1-cyano-5-nitrobenzene 1-CYANO-2-BROMO-5-NITROBENZENE |
| CAS | 134604-07-2 |
| InChI | InChI=1/C7H3BrN2O2/c8-7-2-1-6(10(11)12)3-5(7)4-9/h1-3H |
| Molecular Formula | C7H3BrN2O2 |
| Molar Mass | 227.01 |
| Density | 1.81±0.1 g/cm3(Predicted) |
| Melting Point | 118-120 °C |
| Boling Point | 321.1±32.0 °C(Predicted) |
| Flash Point | 148°C |
| Vapor Presure | 0.000304mmHg at 25°C |
| Storage Condition | 2-8°C |
| Sensitive | Moisture Sensitive |
| Refractive Index | 1.638 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37 - Wear suitable protective clothing and gloves. S60 - This material and its container must be disposed of as hazardous waste. |
| UN IDs | 2811 |
| WGK Germany | 3 |
| HS Code | 29269090 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | Ⅲ |