135306-45-5 - Names and Identifiers
| Name | 3,5-difluoropropiophenone
|
| Synonyms | 3,5-DIFLUOROPROPIOPHENOL 3,5-difluoropropiophenone 3,5-DIFLUOROPROPIOPHENONE 3,5-Difluoropropiophenone 3',5'-DIFLUOROPROPIOPHENONE 1-(3,5-difluorophenyl)propan-2-one 1-(3,5-difluorophenyl)propan-1-one 1-(3,5-difluorophenyl)-1-propanone 1-Propanone, 1-(3,5-difluorophenyl)-
|
| CAS | 135306-45-5
|
| EINECS | 642-876-2 |
| InChI | InChI=1/C9H8F2O/c1-6(12)2-7-3-8(10)5-9(11)4-7/h3-5H,2H2,1H3 |
135306-45-5 - Physico-chemical Properties
| Molecular Formula | C9H8F2O
|
| Molar Mass | 170.16 |
| Density | 1.166±0.06 g/cm3(Predicted) |
| Melting Point | 25 °C |
| Boling Point | 82°C 10mm |
| Flash Point | 82°C/10mm |
| Vapor Presure | 0.513mmHg at 25°C |
| BRN | 7422838 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.472 |
| MDL | MFCD00061142 |
135306-45-5 - Risk and Safety
| Hazard Symbols | Xi - Irritant

|
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36 - Wear suitable protective clothing.
S36/37 - Wear suitable protective clothing and gloves.
|
| Hazard Class | IRRITANT |
135306-45-5 - Introduction
3,5-difluoropropiophenone, chemical formula C9H6F2O, is a difluorophenyl containing organic compounds. The following is a description of the nature, use, preparation and safety information of 3,5-difluoropropiophenone:
Nature:
1. Appearance: 3,5-difluorophenyl acetone is a colorless crystalline solid.
2. Solubility: It has good solubility in organic solvents, such as alcohols, ethers and ketones.
3. Melting point: The melting point of 3,5-difluorophenyl acetone is 45-47 ℃.
4. Stability: It is stable at room temperature, but will decompose at high temperature.
Use:
1. 3,5-difluoropropiophenone is an important organic synthesis intermediate, which can be used to synthesize other organic compounds.
2. it can be used as a raw material for pesticide synthesis.
3. 3,5-difluoropropiophenone can also be used as an intermediate for the synthesis of certain drugs.
Preparation Method:
Generally, 3,5-difluoropropiophenone can be synthesized by the following steps:
1. First, benzene is reacted with hydrogen fluoride to obtain 3,5-difluorobenzene.
2. Then, 3,5-difluorobenzene and acetone are subjected to an acylation reaction to obtain 3,5-difluorophenyl acetone.
Safety Information:
1. 3,5-Difluoropropiophenone is a chemical that requires safe handling and proper protective equipment such as gloves and goggles.
2. It is a combustible substance, which should be kept away from open flames and heat sources.
3. avoid contact with the skin and eyes, such as accidental contact, should immediately rinse with plenty of water and seek medical attention.
4. When storing and handling, you should comply with the relevant chemical regulations and keep it in a dry, cool, and well-ventilated place.
Last Update:2024-04-09 21:01:54