| Name | 1-(6-hydroxy-2-naphthyl)ethan-1-one |
| Synonyms | 135354 6-Acetyl-2-naphthol Methyl(6-hydroxy-2-naphtyl) ketone 1-(6-hydroxy-2-naphthyl)ethan-1-one 1-(6-Hydroxy-2-naphthalenyl)ethanone 1-(6-hydroxynaphthalen-2-yl)ethanone 1-(6-Hydroxynaphthalen-2-yl)ethan-1-one Ethanone, 1-(6-hydroxy-2-naphthalenyl)- |
| CAS | 10441-41-5 |
| EINECS | 233-923-4 |
| InChI | InChI=1/C12H10O2/c1-8(13)9-2-3-11-7-12(14)5-4-10(11)6-9/h2-7,14H,1H3 |
| Molecular Formula | C12H10O2 |
| Molar Mass | 186.21 |
| Density | 1.36 g/cm3 |
| Melting Point | 171 °C(Solv: benzene (71-43-2)) |
| Boling Point | 370.1±15.0 °C(Predicted) |
| Flash Point | 158°C |
| Solubility | Chloroform (Slightly, Heated, Sonicated), Methanol (Slightly) |
| Vapor Presure | 5.31E-06mmHg at 25°C |
| Appearance | Solid |
| Color | Off-White to Pale Yellow |
| pKa | 8.75±0.40(Predicted) |
| Storage Condition | -20°C Freezer |
| Refractive Index | 1.65 |
| Physical and Chemical Properties | Prismatic Crystal (benzene). Melting point 171 °c. Yellow solution in alkali solution. |
| use | naproxen intermediate. |
| production method | can be made from β-naphthol. |