| Name | Isonicotinic acid N-oxide |
| Synonyms | RARECHEM AL BO 1255 isonicotinic-N-oxide acid ISONICOTINIC ACID N-OXIDE Isonicotinic acid N-oxide Isonicotinic acid-N-oxide pyridine-4-carboxylate 1-oxide 4-pyridinecarboxylicacid,1-oxide pyridin-N-oxide-4-carboxylic acid pyridine-4-carboxylic acid 1-oxide PYRIDINE-4-CARBOXYLIC ACID 1-OXIDE PYRIDINE-4-CARBOXYLIC ACID N-OXIDE Pyridine-4-carboxylic acid N-oxide |
| CAS | 13602-12-5 |
| EINECS | 237-086-6 |
| InChI | InChI=1/C6H5NO3/c8-6(9)5-1-3-7(10)4-2-5/h1-4H,(H,8,9)/p-1 |
| Molecular Formula | C6H5NO3 |
| Molar Mass | 139.11 |
| Density | 1.4429 (rough estimate) |
| Melting Point | 270-271°C(lit.) |
| Boling Point | 255.04°C (rough estimate) |
| Flash Point | 237.4°C |
| Vapor Presure | 1.34E-09mmHg at 25°C |
| Appearance | Slightly beige |
| Color | White to Light yellow to Light red |
| BRN | 119571 |
| pKa | 3.66±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.5423 (estimate) |
| MDL | MFCD00006209 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| TSCA | Yes |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |