136274-57-2 - Names and Identifiers
| Name | (r,r'')-2,2''-bis(diphenylphosphino)-1,1''-biferrocene
|
| Synonyms | (R,R'')-2,2''-Bis(diphenylphosphino)-1,1''-biferrocen (R,R'')-2,2''-Bis(diphenylphosphino)-1,1''-biferrocene (r,r'')-2,2''-bis(diphenylphosphino)-1,1''-biferrocene
|
| CAS | 136274-57-2
|
| InChI | InChI=1/C34H26P2.2C5H5.2Fe/c1-5-15-27(16-6-1)35(28-17-7-2-8-18-28)33-25-13-23-31(33)32-24-14-26-34(32)36(29-19-9-3-10-20-29)30-21-11-4-12-22-30;2*1-2-4-5-3-1;;/h1-26H;2*1-5H;;/rC44H36Fe2P2/c1-5-21-35(22-6-1)47(36-23-7-2-8-24-36)41-31-29-39(45-33-17-13-14-18-33)43(41)44-40(46-34-19-15-16-20-34)30-32-42(44)48(37-25-9-3-10-26-37)38-27-11-4-12-28-38/h1-34,39-40H |
136274-57-2 - Physico-chemical Properties
| Molecular Formula | C34H26P2.2C5H5.2Fe
|
| Molar Mass | 738.406 |
| Melting Point | 232 °C |
| Solubility | soluble in Chloroform |
| Appearance | powder to crystal |
| Color | Light yellow to Yellow to Orange |
| Storage Condition | Room Temprature |
136274-57-2 - Introduction
(R,R'')-2,2 ''-bis (diphenylphosphino)-1,1''-bisferrocene is an organometallic compound. It has the following properties:
1. Appearance:(R,R'')-2,2 ''-bis (diphenylphosphino)-1,1''-diferrocene is a red crystalline solid.
2. Stability: It has relatively good stability to air and water.
3. Solubility: It can be dissolved in non-polar solvents, such as petroleum ether and dimethylformamide.
(R,R'')-2,2 ''-bis (diphenylphosphino)-1,1''-diferrocene is mainly used in the field of organic synthesis and has the following applications:
1. Diiron dimetallocene complexes substituted with ortho-diphenylphosphino are widely used in the synthesis of chiral ligands and catalysts.
2. It can be used as a catalyst for asymmetric catalytic reactions, such as asymmetric hydrogenation, asymmetric olefin hydrogenation and asymmetric nucleophilic substitution reactions.
3. It can also be used in the field of organic solar cells, optoelectronic devices and photodynamic formation.
A common method for preparing (R,R'')-2,2 ''-bis (diphenylphosphino)-1,1''-bisferrocene is through a Grignard reaction. Specific steps are as follows:
1. Diphenylphosphino sodium is reacted with ferrocene under an inert atmosphere.
2. After the reaction is complete, the product is obtained by cooling the solution and water crystallization.
3. Finally, recrystallize by solvent or dry under reduced pressure to obtain pure product.
4. Pay attention to ensure that the operation is under an inert atmosphere during the synthesis process, and pay attention to the safe operation of handling organometallic compounds.
For safety information, here are some suggestions:
1. Try to avoid direct contact with the substance, wear protective gloves and respiratory protection.
2. Good ventilation should be ensured during laboratory operation to avoid inhalation or skin absorption.
3. For any accident, immediately flush the affected area with plenty of water and seek medical help.
4. Waste disposal shall comply with local regulations and safety requirements.
Last Update:2024-04-09 18:58:34