| Name | Tilmicosin phosphate |
| Synonyms | tilmicosina fosfato Timicosin Phosphate Tilmicosin phosphate TILMICOSIN PHOSPHATE Phosphate Tilmicosin TilMicosin Base( Phosphate) tilmicosin phosphate(animal use) Tilmicosin phosphate in stock GMP Factory 20-deoxo-20-(3,5-dimethyl-1-piperidinyl)desmycosin phosphate 20-Deoxy-20-(3,5-diMethylpiperidin-1-yl)-desMycosin phosphate 2-(dimethylamino)-2-oxoethyl (2R)-2-(2-methyl-5H-chromeno[2,3-b]pyridin-7-yl)propanoate |
| CAS | 137330-13-3 |
| EINECS | 641-061-9 |
| InChI | InChI=1/C20H22N2O4/c1-12-5-6-15-10-16-9-14(7-8-17(16)26-19(15)21-12)13(2)20(24)25-11-18(23)22(3)4/h5-9,13H,10-11H2,1-4H3/t13-/m1/s1 |
| Molecular Formula | C46H83N2O17P |
| Molar Mass | 967.13 |
| Density | 1.219g/cm3 |
| Melting Point | >160°C (dec.) |
| Boling Point | 528.7°C at 760 mmHg |
| Flash Point | 273.5°C |
| Solubility | DMSO (Slightly), Methanol (Very Slightly) |
| Vapor Presure | 2.91E-11mmHg at 25°C |
| Appearance | Pale yellow powder |
| Color | White to Off-White |
| Storage Condition | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| Refractive Index | 1.578 |
| Use | This product is for scientific research only and shall not be used for other purposes. |