| Name | 2-FLUORO-3-METHOXYBENZOIC ACID |
| Synonyms | 3-Carboxy-2-fluoroanisole 2-fluoro-3-methoxybenzoate 2-Fluoro-3-Methoxybenzoic acd 2-FLUORO-3-METHOXYBENZOIC ACID Benzoic acid, 2-fluoro-3-methoxy- 2-Fluoro-3-Methoxybenzoic Acid(WX612106) |
| CAS | 137654-20-7 |
| EINECS | 630-179-6 |
| InChI | InChI=1/C8H7FO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,1H3,(H,10,11) |
| Molecular Formula | C8H7FO3 |
| Molar Mass | 170.14 |
| Density | 1.307±0.06 g/cm3(Predicted) |
| Melting Point | 157-160°C |
| Boling Point | 296.6±20.0 °C(Predicted) |
| Flash Point | 133.2°C |
| Vapor Presure | 0.000641mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow |
| pKa | 3.15±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.524 |
| MDL | MFCD02179621 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| Hazard Class | IRRITANT |