| Name | 7-Methoxy-1-naphthylacetonitrile |
| Synonyms | Agomelatine Intermediate 1 AgoMelatine interMediate A 7-Methoxy-1-naphthylacetonitrile 7-methoxy-1-naphthyl acetonitrile 1-Cyanomethyl-7-methoxynaphthalene 7-Methoxy-1-naphthaleneacetinitrile 2-(7-Methoxy-1-naphthyl)acetonitrile (7-methoxynaphthalen-1-yl)acetonitrile 2-(7-methoxynaphthalen-1-yl)acetonitrile N-[2-(7-Methoxy-1-naphthyl)ethyl]acetaMide |
| CAS | 138113-08-3 |
| InChI | InChI=1/C13H11NO/c1-15-12-6-5-10-3-2-4-11(7-8-14)13(10)9-12/h2-6,9H,7H2,1H3 |
| Molecular Formula | C13H11NO |
| Molar Mass | 197.23 |
| Density | 1.135±0.06 g/cm3(Predicted) |
| Melting Point | 81-83°C |
| Boling Point | 374.3±17.0 °C(Predicted) |
| Flash Point | 157.7°C |
| Solubility | slightly sol. in Methanol |
| Vapor Presure | 0.001Pa at 25℃ |
| Appearance | Solid |
| Color | White to Light yellow to Light orange |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.44 |
| Use | Intermediate, For the preparation of agomelatine |
| UN IDs | UN 3439 6.1/PG III |
| Hazard Class | 6.1 |
| Packing Group | III |
| LogP | 2.79 at 26℃ and pH7 |
| surface tension | 73.1mN/m at 12.33mg/L and 20 ℃ |
| use | can be used as organic synthesis raw materials, pharmaceutical intermediates and organic solvents |