| Name | 1-bromo-3,4,5-trifluorobenzene |
| Synonyms | 3,4,5-TRIFLUOROBROMOBENZENE 3,4,5-trifluorobromobenzene 3,4,5-Ttrifluorobromobenzene 2,4-difluoro-N-methylaniline 3,4,5-trifluoro bromobenzene 1-BROMO-3,4,5-TRIFLUOROBENZENE 1,2,3-TRIFLUORO-5-BROMOBENZENE 5-Bromo-1,2,3-trifluorobenzene 1-Bromo-3,4,5-trifluoribenzene 1-bromo-3,4,5-trifluorobenzene 3,4,5-Trifluoro-1-bromobenzene 5-BROMO-1,2,3-TRIFLUOROBENZENE BENZENE, 5-BROMO-1,2,3-TRIFLUORO- |
| CAS | 138526-69-9 |
| EINECS | 418-480-9 |
| InChI | InChI:1S/C6H2BrF3/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |
| InChIKey | HKJCELUUIFFSIN-UHFFFAOYSA-N |
| Molecular Formula | C6H2BrF3 |
| Molar Mass | 210.98 |
| Density | 1.767g/mLat 25°C(lit.) |
| Melting Point | <-20°C |
| Boling Point | 47-49°C60mm Hg(lit.) |
| Flash Point | 113°F |
| Water Solubility | insoluble |
| Solubility | 0.130g/l |
| Vapor Presure | 1.6mmHg at 25°C |
| Specific Gravity | 1.78 |
| BRN | 7249191 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.482(lit.) |
| MDL | MFCD00042472 |
| Physical and Chemical Properties | Colorless transparent liquid. |
| Risk Codes | R10 - Flammable R38 - Irritating to the skin R40 - Limited evidence of a carcinogenic effect R41 - Risk of serious damage to eyes R51/53 - Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S23 - Do not breathe vapour. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S61 - Avoid release to the environment. Refer to special instructions / safety data sheets. S36 - Wear suitable protective clothing. S16 - Keep away from sources of ignition. |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 2 |
| HS Code | 29036990 |
| Hazard Note | Irritant |
| Hazard Class | 3 |
| Packing Group | III |
| chemical properties | colorless transparent liquid. |
| use | as a pharmaceutical intermediate |