| Name | 2-(Diphenylphosphino)-biphenyl |
| Synonyms | biphenyl-2-yldiphenylphosphine 2-(DiphenylphosphiNA)-biphenyl 2-(Diphenylphosphino)-biphenyl o-Phenylphenyldiphenylphosphane 2-Biphenylyl(diphenyl)phosphine biphenyl-2-yl(diphenyl)phosphane [1,1'-Biphenyl]-2-yldiphenylphosphine |
| CAS | 13885-09-1 |
| EINECS | 808-087-4 |
| InChI | InChI=1/C24H19P/c1-4-12-20(13-5-1)23-18-10-11-19-24(23)25(21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-19H |
| Molecular Formula | C24H19P |
| Molar Mass | 338.38 |
| Melting Point | 80.0 to 86.0 °C |
| Boling Point | 473.2±24.0 °C(Predicted) |
| Flash Point | 254.4°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 1.15E-08mmHg at 25°C |
| Appearance | White crystal |
| Color | White to Almost white |
| Storage Condition | Inert atmosphere,Room Temperature |
| MDL | MFCD11559063 |
| Physical and Chemical Properties | White crystals |
| Use | as a ligand for coupling reactions |