| Name | 2-Mercapto-4(3H)-quinazolinone |
| Synonyms | 2-Mercapto-4-quinazolinol 2-THIO-4(3H)-QUINAZOLINONE 2-MERCAPTOQUINAZOLIN-4-ONE 2-MERCAPTO-4(3H)-QUINAZOLINONE 2-Mercapto-4(3H)-quinazolinone 2-MERCAPTOQUINAZOLIN-4(3H)-ONE 2-thioxo-2,3-dihydroquinazolin-4(1H)-one 2,3-Dihydro-2-thioxo-4(1H)-quinazolinone 2,3-dihydro-2-thioxoquinazolin-4(1H)-one 2,3-Dihydro-2-thioxoquinazolin-4(1H)-one 1,2,3,4-Tetrahydro-2-thioxoquinazoline-4-one |
| CAS | 13906-09-7 |
| EINECS | 237-676-3 |
| InChI | InChI=1/C8H6N2OS/c11-7-5-3-1-2-4-6(5)9-8(12)10-7/h1-4H,(H2,9,10,11,12) |
| Molecular Formula | C8H6N2OS |
| Molar Mass | 178.21 |
| Density | 1.46±0.1 g/cm3(Predicted) |
| Melting Point | >300 °C (lit.) |
| Boling Point | 330.5°C at 760 mmHg |
| Flash Point | 153.7°C |
| Vapor Presure | 0.000165mmHg at 25°C |
| pKa | 9.49±0.20(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.728 |
| MDL | MFCD00006885 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |