| Name | 1,2-Bis(dimethylphosphino)benzene |
| Synonyms | dppbe dppBz dppben dppbenz o-bis(diphenylphosphino)benzene 1,2-Bis(dimethylphosphino)benzene 1,2-Bis(diphenylphosphino)benzene 1,2-BIS(DIPHENYLPHOSPHINO)BENZENE 1,2-Bis(diphenylphosphanyl)benzene benzene-1,2-diylbis(diphenylphosphane) |
| CAS | 13991-08-7 |
| InChI | InChI=1/C30H24P2/c1-5-15-25(16-6-1)31(26-17-7-2-8-18-26)29-23-13-14-24-30(29)32(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-24H |
| InChIKey | NFRYVRNCDXULEX-UHFFFAOYSA-N |
| Molecular Formula | C30H24P2 |
| Molar Mass | 446.47 |
| Melting Point | 183-188 °C (lit.) |
| Boling Point | 546.9±33.0 °C(Predicted) |
| Flash Point | 302.787°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | White powder or crystal |
| Color | White |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | Air Sensitive |
| MDL | MFCD00014081 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29319090 |
| Application | 1,2-bis (diphenylphosphino) benzene (dppbz) is an organic phosphine compound, mainly used for organic reactions The ligand can be used in laboratory research and development processes and chemical production processes. |