| Name | 1-Chloro-2,4-difluorobenzene |
| Synonyms | 2,4-Difluorchlorbenzol 2,4-Diflurochlorobenzene 2,4-Difluorochlorobenzene 2,4-DIFLUOROCHLOROBENZENE 2,4-Difluorophenyl chloride 1-CHLORO-2,4-DIFLUOROBENZENE 1-Chloro-2,4-difluorobenzene Benzene,1-chloro-2,4-difluoro- |
| CAS | 1435-44-5 |
| EINECS | 604-365-2 |
| InChI | InChI=1/C6H3ClF2/c7-5-2-1-4(8)3-6(5)9/h1-3H |
| InChIKey | AJCSNHQKXUSMMY-UHFFFAOYSA-N |
| Molecular Formula | C6H3ClF2 |
| Molar Mass | 148.54 |
| Density | 1.353 g/mL at 25 °C (lit.) |
| Melting Point | -26 °C |
| Boling Point | 127 °C (lit.) |
| Flash Point | 91°F |
| Specific Gravity | 1.353 |
| BRN | 2081077 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.475(lit.) |
| Physical and Chemical Properties | Storage Conditions: flagmables area WGK Germany:2 |
| Risk Codes | R10 - Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 2 |
| HS Code | 29039990 |
| Hazard Note | Flammable |
| Hazard Class | 3 |
| Packing Group | III |
| chemical properties | colorless liquid |