| Name | 3,5-dichlorofluorobenzene |
| Synonyms | 3,5-DICHLOROFLUOROBENZENE 3,5-dichlorofluorobenzene 1,3-Dichloro-5-fluorobenzene 1,3-dichloro-5-fluorobenzene 3,5-Dichloro-1-fluorobenzene Benzene, 1,3-dichloro-5-fluoro- |
| CAS | 1435-46-7 |
| InChI | InChI=1/C6H3Cl2F/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| Molecular Formula | C6H3Cl2F |
| Molar Mass | 164.99 |
| Density | 1.37 g/cm |
| Boling Point | 68 °C |
| Flash Point | 54.8°C |
| Vapor Presure | 2.55mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1,519 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | 1993 |
| Hazard Class | IRRITANT |
| Packing Group | III |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |