| Name | 5-aminopyridine-2-carboxamide |
| Synonyms | 5-AMinopicolinaMide 5-Aminopyridine-2-carboxamide 5-aminopyridine-2-carboxamide 5-AMino-2-pyridine carboxaMide 2-Pyridinecarboxamide, 5-amino- 2-pyridinecarboxamide, 5-amino- 2-Pyridinecarboxamide,5-amino-(9CI) 5-AMINOPYRIDINE-2-CARBOXAMIDE,PURITY 5-aminopyridine-2-carboxylic acid amide |
| CAS | 145255-19-2 |
| EINECS | 1312995-182-4 |
| InChI | InChI=1/C6H7N3O/c7-4-1-2-5(6(8)10)9-3-4/h1-3H,7H2,(H2,8,10) |
| Molecular Formula | C6H7N3O |
| Molar Mass | 137.14 |
| Density | 1.323g/cm3 |
| Boling Point | 427.311°C at 760 mmHg |
| Flash Point | 212.23°C |
| Vapor Presure | 0mmHg at 25°C |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.644 |
| Overview | 5-amino-2-pyridinecarboxamide is an organic compound that can be used as an intermediate in the synthesis of pharmaceuticals and chemicals. |
| emergency | if inhaling 5-amino-2-pyridinecarboxamide, move the patient to fresh air; if the skin is in contact, take off the contaminated clothing and rinse the skin thoroughly with soap and water. If you feel uncomfortable, seek medical advice, and immediately see a doctor; If you eat, immediately gargle, prohibit emetic, should immediately see a doctor. |