| Name | 3-FLUORO-2-IODOPYRIDINE |
| Synonyms | uoro-2-iodo-pyridine 3-FLUORO-2-IODOPYRIDINE 2-IODO-3-FLUOROPYRIDINE Pyridine, 3-fluoro-2-iodo- |
| CAS | 146141-04-0 |
| EINECS | 1308068-626-2 |
| InChI | InChI=1/C6H6FNO/c1-9-6-5(7)3-2-4-8-6/h2-4H,1H3 |
| Molecular Formula | C5H3FIN |
| Molar Mass | 222.99 |
| Density | 2.046±0.06 g/cm3(Predicted) |
| Boling Point | 203.1±20.0 °C(Predicted) |
| pKa | -0.58±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.471 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |