| Name | 3-Chloro-4,5-difluorobenzoic acid |
| Synonyms | 5-Chloro-3,4-difluorobenzoic acid 3-CHLORO-4,5-DIFLUOROBENZOIC ACID 3-Chloro-4,5-difluorobenzoic acid benzoic acid, 3-chloro-4,5-difluoro- Benzoic acid, 3-chloro-4,5-difluoro- |
| CAS | 150444-95-4 |
| InChI | InChI=1/C7H3ClF2O2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,(H,11,12) |
| Molecular Formula | C7H3ClF2O2 |
| Molar Mass | 192.55 |
| Density | 1.573±0.06 g/cm3(Predicted) |
| Boling Point | 283.3±35.0 °C(Predicted) |
| Flash Point | 125.1°C |
| Vapor Presure | 0.0015mmHg at 25°C |
| pKa | 3.43±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.534 |
| use | 3-chloro -4, 5-difluorobenzoic acid is an increasingly versatile intermediate and a commonly used intermediate for the synthesis of liquid crystal compounds, pharmaceutical compounds and pesticide compounds. |