| Name | 2-hydrazino-1,3-benzoxazole |
| Synonyms | AURORA 23338 OTAVA-BB BB0116640014 Hydrazino-1,3-benzoxazole Benzoxazole, 2-hydrazinyl- BENZOOXAZOL-2-YL-HYDRAZINE 2-HYDRAZINO-1,3-BENZOXAZOLE 2-hydrazino-1,3-benzoxazole 2-hydrazinyl-1,3-benzoxazole |
| CAS | 15062-88-1 |
| InChI | InChI=1/C7H7N3O/c8-10-7-9-5-3-1-2-4-6(5)11-7/h1-4H,8H2,(H,9,10) |
| Molecular Formula | C7H7N3O |
| Molar Mass | 149.15 |
| Density | 1.404g/cm3 |
| Melting Point | >136°C (dec.) |
| Boling Point | 297.4°C at 760 mmHg |
| Flash Point | 133.7°C |
| Solubility | Chloroform (Slightly), DMSO (Sparingly), Methanol (Slightly) |
| Vapor Presure | 0.00135mmHg at 25°C |
| Appearance | Solid |
| Color | Pale Yellow |
| Storage Condition | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.743 |
| Hazard Symbols | Xi - Irritant![]() |
| Hazard Class | IRRITANT |
| Overview | 2-hydrazin-1, 3-benzoxazole can be obtained by the reaction of 2-chlorobenzoxazole and hydrazine hydrate, which can be used to prepare a class of pyrazole compounds. |
| Uses | 2-hydrazin-1, 3-benzoxazole is a heterocyclic organic substance, which can be used as an organic intermediate. |