| Name | 3-(2-Bromophenyl)propionic acid |
| Synonyms | O-broMophenolpropionic acid 2-bromobenzenepropionic acid 2-BroMo-benzenepropanoic acid Benzenepropanoic acid,2-broMo- 3-(2-Bromophenyl)propionic acid 3-(2-bromophenyl)propanoic acid 3-(2-Bromophenyl)propanoic acid 3-(2-BROMOPHENYL)PROPIONIC ACID |
| CAS | 15115-58-9 |
| InChI | InChI=1/C9H9BrO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12) |
| InChIKey | AOACQJFIGWNQBC-UHFFFAOYSA-N |
| Molecular Formula | C9H9BrO2 |
| Molar Mass | 229.07 |
| Density | 1.531±0.06 g/cm3(Predicted) |
| Melting Point | 98-102 °C (lit.) |
| Boling Point | 186°C/15mmHg(lit.) |
| Flash Point | 153.999°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | White powder |
| Color | White to Orange to Green |
| pKa | 4.60±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.579 |
| MDL | MFCD01310791 |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 3261 |
| WGK Germany | 2 |
| HS Code | 29163990 |
| Hazard Class | IRRITANT |