| Name | 4-CHLORO-INDAN-1-ONE |
| Synonyms | 4-choroindanone 4-Chloro-1-Indanone 4-CHLORO-INDAN-1-ONE 4-chloro-2,3-dihydroinden-1-one 4-Chloro-2,3-dihydro-1H-inden-1-one 4-chloro-2,3-dihydro-1H-inden-1-one 1H-Inden-1-one, 4-chloro-2,3-dihydro- |
| CAS | 15115-59-0 |
| InChI | InChI=1/C9H7ClO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3H,4-5H2 |
| Molecular Formula | C9H7ClO |
| Molar Mass | 166.6 |
| Density | 1.312±0.06 g/cm3(Predicted) |
| Melting Point | 90-92℃ |
| Boling Point | 285.8±29.0 °C(Predicted) |
| Flash Point | 128.3°C |
| Vapor Presure | 0.00274mmHg at 25°C |
| Appearance | White to yellow crystals or oily |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.6 |
| Use | 4-chloro-1-indanone is a 2, 3-dihydro-1-indanone derivative. 2, 3-dihydro-1-indanone derivative is a very important organic intermediate. They are widely used in pharmaceutical and chemical industries, catalytic ligands, liquid crystal materials and other fields. |