| Name | 4-Bromo-1-indanone |
| Synonyms | 4-bromoindanone 4-Bromo indanone 4-bromo-1-indanon 4-Bromo-1-indanone 4-BROMO-INDAN-1-ONE 1-Indanone, 4-bromo- 4-bromo-2,3-dihydroinden-1-one 4-BROMO-2,3-DIHYDRO-1H-INDEN-1-ONE 1H-Inden-1-one, 4-bromo-2,3-dihydro- |
| CAS | 15115-60-3 |
| EINECS | 628-019-5 |
| InChI | InChI=1/C9H7BrO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3H,4-5H2 |
| InChIKey | UVVYFYLSZIMKMC-UHFFFAOYSA-N |
| Molecular Formula | C9H7BrO |
| Molar Mass | 211.06 |
| Density | 1.608±0.06 g/cm3(Predicted) |
| Melting Point | 95-99°C(lit.) |
| Boling Point | 125°C/1.5mmHg(lit.) |
| Flash Point | 120.5°C |
| Vapor Presure | 0.000892mmHg at 25°C |
| Appearance | Crystallization |
| Color | Orange-brown |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.622 |
| MDL | MFCD01719772 |
| Physical and Chemical Properties | WGK Germany:2 RTECS:NK7536100 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | S22 - Do not breathe dust. S60 - This material and its container must be disposed of as hazardous waste. S36 - Wear suitable protective clothing. |
| WGK Germany | 2 |
| RTECS | NK7536100 |
| HS Code | 29147000 |
| introduction | 4-bromo-1-indanone is a white to yellow powdery substance and can be used as a pharmaceutical intermediate. |
| Uses | 4-bromo-1-indenone is used to prepare N'-indanyl-N-benzopyrazolyl urea, which can be used as an analgesic TRPV1 antagonist; It is also used to synthesize 1,4-dihydroindeno [1,2-c] pyrazole compounds used as KDR kinase inhibitors. |