| Name | 2-Butyl-4-spirocyclopentane-2-imidazolin-5-one hydrochloride |
| Synonyms | 151257-01-1 2-butyl-1,3-diazo spiro[4,4] non-1-en-4-one HCl 2-Butyl-1,3-diazaspiro[4.4]non-1-en-4-one hydrochloride 2-Butyl-4-spirocyclopentane-2-imidazolin-5-one hydrochloride |
| CAS | 151257-01-1 |
| InChI | InChI=1/C11H18N2O.ClH/c1-2-3-6-9-12-10(14)11(13-9)7-4-5-8-11;/h2-8H2,1H3,(H,12,13,14);1H |
| Molecular Formula | C11H19ClN2O |
| Boling Point | 328.6°C at 760 mmHg |
| Flash Point | 152.6°C |
| Vapor Presure | 0.000135mmHg at 25°C |
| Appearance | White or light white crystal powder |
| Storage Condition | Room Temprature |
| Use | As an intermediate in the synthesis of irbesartan for the treatment of hypertension |